Выберите букву:

Химия - тест

Вы можете купить эту работу on-line прямо сейчас за 150 рублей с помощью системы «Робокасса» или положить работу в корзину
Задание 1

Вопрос 1. Какие из приведенных соединений относятся к основным оксидам: а)NO, б)MgO, в)BaO2, г)Na2O, д) Mn2O7?

1. а, д

2. в, г

3. б, г

4. в, д

5. а, б

Вопрос 2.С какими из перечисленных веществ будет взаимодействовать оксид кальция: а)H2O, б)PbO, в)CO2, г)NaCl, д)HCl?

1. а, в

2. а, в, д

3. б, в, г

4. в, г, д

5. а, г, д

Вопрос 3. Какие из приведенных веществ относятся к кислотным оксидам: а)CrO3, б)CO, в)N2O5, г)BaO, д)SnO?

1. а, в

2. а, б, в

3. в, д

4. а, б

5. б, в, г

Вопрос 4. С какими из перечисленных веществ будет взаимодействовать оксид серы (VI): а)Ba(OH)2, б)KI, в)H2O, г)CaO, д)H2S?

1. а, в, г

2. б, в, г

3. в, г, д

4. а, в, д

5. а, б, д

Вопрос 5. Какие из перечисленных оксидов относятся к несолеобразующим: а)CoO, б)N2O, в)CO, г)N2O5, д)NO

1. а, б, г

2. б, в, д

3. б, в, г

4. в, г, д

5. а, в, д



Задание 2
Вопрос 1. Какие из перечисленных веществ относятся к основаниям: а)KOH, б)CH3OH, в)Ge(OH)4, г)Cu(OH)2, д)Sr(OH)2?

1. а, в, г

2. а, г, д

3. б, в, г

4. в, г, д

5. а, в, д

Вопрос 2. Какие из перечисленных оксидов при взаимодействии с водой дают растворимые основания (щелочи): а)BaO, б)CuO, в)Li2O, г)MgO, д)Al2O3?

1. а, в

2. а, в, г

3. в, г

4. б, г, д

5. б, д

Вопрос 3. Какие из перечисленных гидроксидов при нагревании разлагаются на оксид и воду: а)KOH, б)Ca(OH)2, в)Ba(OH)2, г)Fe(OH)3, д)Al(OH)3?

1. а, б, в

2. б, г, д

3. г, д

4. б, в, г

5. в, г

Вопрос 4. С какими из перечисленных веществ будет взаимодействовать гидроксид натрия: а)HNO3, б)BaSO4, в)SO2, г)FeO, д)CuCl2?

1. а, в, д

2. в, д

3. а, б, в

4. в, г, д

5. б, г

Вопрос 5. С какими из перечисленных веществ будет взаимодействовать гидроксид меди: а)HCl, б)BaCl2, в)CO2, г)H2SO4, д)KCl?

1. а, б

2. а, г

3. в, г

4. а, в, г

5. в, г, д



Задание 3
Вопрос 1. Какие из перечисленных веществ относятся к амфотерным оксидам: а)CoO, б)ZnO,, в)Cr2O3, г)MgO, д)BeO?

1. а, б, в

2. б, в, г

3. в, г, д

4. б, г, д

5. б, в, д

Вопрос 2. С какими из перечисленных веществ будет взаимодействовать оксид алюминия: а)NaOH, б)CO2, в)HCl, г)Li2O, д)SiO2?

1. а, в, г, д

2. а, б, в, д

3. б, в, г

4. в, г. д

5. а, б, г, д

Вопрос 3. Какие из перечисленных веществ относятся к амфотерным гидроксидам: а)Fe(OH)2, б)Al(OH)3, в)Ca(OH)2, г)Zn(OH)2 д)Ni(OH)2?

1. а, б, в

2. б, г, д

3. в, г

4. г, д

5. б, г

Вопрос 4. С какими из перечисленных веществ будет взаимодействовать гидроксид хрома (III): а)SO2, б)NaOH, в)H2SO4, г)KNO3, д)Cu(OH)2?

1. а, б,

2. б, в

3. б, в, д

4. в, г, д

5. б, д

Вопрос 5. Что будет происходить с гидроксидом цинка при нагревании? Напишите соответствующее уравнение реакции. Укажите сумму коэффициентов в этом уравнении:

1. 3

2. 4

3. 5

4. 6

5. 7



Задание 4.

Вопрос 1. Укажите формулы хлорной, марганцовистой, ортофосфорной кислот:

1. HClO, H2MnO4, HPO3

2. HCl, HMnO­4, H3PO4

3. HClO4, H2MnO4, H3PO4

4. HClO3, H2MnO4, H3PO4

5. HClO4, HMnO4, HPO2

Вопрос 2. Укажите оксиды, при взаимодействии которых с водой образуются кислоты: а)NO, б)SO2, в)SiO2, г)CaO, д) CrO3.

1. а, б, в

2. б, в

3. в, г, д

4. б, д

5. в, д

Вопрос 3. С какими из перечисленных веществ будет взаимодействовать разбавленная серная кислота: а)MgO, б)CO2, в)CaCl2 г)Al(OH)3, д)NaNO3?

1. а, б, в

2. б, в, г

3. в, г

4. б, д

5. а, в, г

Вопрос 4. С какими из перечисленных веществ будет взаимодействовать соляная кислота: а)Fe, б)AgNO3, в)Na2SO4, г)Cu, д)Ca(OH)2?

1. а, б, д

2. б, в, г

3. а, д

4. б, в, д

5. а, б

Вопрос 5. Какие газы выделяются при взаимодействии меди с разбавленной H2SO4, концентрированной H2SO4, разбавленной HNO3, концентрированной HNO3 при комнатной температуре?

1. H2, SO2, NH3, NO

2. -, SO2, NO, NO2

3. H2, H2S, N2, NO2

4. -, H2S, N2O, NO

5. -, SO2, N2, N2O



Задание 5.

Вопрос 1. Из числа предложенных солей выберите формулы сульфата, сульфита, сульфида, гидросульфата: а)NaHSO3, б)LiHS, в)K2SO4, г)MgS, д)BaSO3, е)Na2S2O3, ж)KHSO4, з)Na2S2O8.

1. а, в, д, ж

2. б, г, е, з

3. в, г, д, ж

4. г, д, е, ж

5. а, д, ж, з

Вопрос 2. Какие из перечисленных кислот могут давать как средние, так и кислые соли: а)HNO3, б)H2CO3, в)CH3COOH, г)H3PO4, д)HCl?

1. а, в, д

2. б, в

3. б, в, г

4. б, г

5. г, д

Вопрос 3. С какими из перечисленных веществ будет взаимодействовать растворенный сульфат меди: а)Ag, б)HCl, в)Mg, г)Fe2O3, д)KOH?

1. а, б, д

2. в, д

3. б, в, д

4. в, г, д

5. б, д

Вопрос 4. С какими из перечисленных веществ будет взаимодействовать раствор хлорида кальция: а)H2SO4, б)Fe, в)Na2CO3, г)SO2, д)Zn(OH)2?

1. б, в

2. а, б, г

3. а, в

4. а, б, в

5. в, д

Вопрос 5. Какие из приведенных солей будут разлагаться при нагревании с выделением газов: а)CaCO3, б)K2CO3, в)K2SO4, г)Mg(NO3)2, д)LiClO4

1. а, б, г

2. б, в

3. в, г, д

4. а, г

5. г, д



Задание 6.

Вопрос 1. Укажите электролиты, которые диссоциируют ступенчато: а)Mg(OH)2, б)HCl, в)MgCl2, г)H3PO4, д)Na3PO4, е)NaOH.

1. а, б, в

2. а, г

3. в, г, д

4. г, д, е

5. г, е

Вопрос 2. Какие из приведенных соединений являются сильными электолитами: а) CaCl2, б)H2O, в)HNO3, г)KOH, д)H2CO3, е)Fe(OH)3, ж)CuSO4, з)CH3COOH

1. а, в, г, д

2. в, г, д, е

3. а, в, г, ж

4. в, г, д, ж

5. б, в, е, з

Вопрос 3. Расположите формулы гидроксидов в порядке возрастания их кислотных свойств: а)H2SiO3, б)HClO4, в)H3PO4, г)H2SO4, д)Al(OH)3.

1. а, д, в, б, г

2. д, а, в, г, б

3. в, б, д, а, г

4. д, а, в, б, г

5. в, д, а, г, б

Вопрос 4. Какая из приведенных реакций в растворах электролитов идет до конца:

1. BaCl2+Na2SO4=BaSO4+2NaCl

2. CaCO3+HCl=CaCl2+H2O+CO2

3. Ca(OH)2+2HNO3=Ca(NO3)2+2H2O

4. Все реакции идут до конца

5. Ни одна не идет до конца

Вопрос 5. В растворах каких из приведенных солей, лакмус покраснеет: а)Al(NO3)3, б)KCl, в)NH4Cl, г)Ba(NO3)2, д)Na2CO3?

1. а, в

2. а, б, в

3. в, г

4. в, г, д

5. б, в, г



Задание 7
Вопрос 1. Найдите в периодической системе элементы, имеющие следующие конфигурации валентных электронов: 3d34s2; 5s2p3.

1. Cr, Sn

2. V, Sb

3. V, Nb

4. Nb, Sb

5. Nb, As

Вопрос 2. Какому атому принадлежит последний валентный электрон, имеющий следующий набор квантовых чисел: n=3, l=1, ml=-1, ms=-1/2?

1. B

2. Al

3. S

4. P

5. Ar

Вопрос 3. Укажите вещества, молекулы которых имеют плоскую конфигурацию из-за sp2- гибридизации центральных атомов: а)CH4, б)BCl3, в)H2SO4, г)SnCl2, д)C2H4.

1. а, б

2. б, г, д

3. г, д

4. б, в, г

5. б, д

Вопрос 4. Укажите вещества с ковалентной полярной связью: а)NO, б)N2, в)KCl, г)H­2S, д)OF2.

1. а, б, г

2. б, г

3. г, д

4. б, в, г

5. а, г, д

Вопрос 5. В каком из указанных соединений имеется ковалентная связь, образованная по донорно-акцепторному механизму?

1. KNO3

2. NaCl

3. NH4Cl

4. CuCl2

5. HgSO4



Задание 8
Вопрос 1. Реакция какого типа всегда является окислительно-восстановительной?

1. реакция соединения (NH3+HCl=NH4Cl)

2. реакция разложения (CaCO3=CaO+CO2)

3. реакция обмена (HCl+KOH=KCl+H2O)

4. реакция замещения (Zn+CuCl2=Cu+ZnCl2)

5. реакция образования комплекса {Cu(OH)2+4NH3=[Cu(NH3)4](OH)2}

Вопрос 2. Расположите приведенные вещества в порядке возрастания степени окисления марганца: а)KMnO4, б)Mn, в)MnO2, г)K2MnO4, д)MnO.

1. д, б, в, а, г

2. б, д, в, а, г

3. б, в, д, г, а

4. б, д, в, г, а

5. в, д, б, а,г

Вопрос 3. Какой из приведенных процессов является процессом восстановления:

1. As-3 As+3

2. Sn+4 Sn+2

3. Cr+3 Cr+6

4. S+4 S+6

5. N0 N+2

Вопрос 4. В какой из указанных реакций сера окисляется?

1. S+Zn ZnS

2. 2S+C CS2

3. S+O2 SO2

4. H2+S H2S

5. Fe+S FeS

Вопрос 5. Расставьте коэффициенты в уравнении: KMnO4+Na2SO3+H2SO4 K2SO4+Na2SO4+MnSO4+H2O. Укажите сумму коэффициентов:

1. 19

2. 20

3. 23

4. 21

5. 25



Задание 9
Вопрос 1. Укажите, какой заряд имеет ион-комплексообразователь в следующем координационном соединении - K[Pt(NH3)Cl5].

1. +3

2. +4

3. +5

4. +6

5. +7

Вопрос 2. В каком координационном соединении ион-комплексообразователь проявляет координационное число равное 6?

1. [Cu(NH3)4]Cl2

2. K2[Cd(CN)4]

3. [Co(NH3)4Cl2]Cl

4. K2[Hg(CN)4]

5. Na2[Zn(CN)4]

Вопрос 3. Какое из комплексных соединений платины образует при диссоциации 3 свободных аниона хлора?

1. [Pt(NH3)2Cl4]

2. [Pt(NH3)3Cl3]Cl

3. [Pt(NH3)4Cl2]

4. K2[PtCl6]

5. [Pt(NH3)5Cl]Cl3

Вопрос 4. В каком из комплексных соединений заряд комплексного иона равен –2?

1. K[AgCl2]

2. [Ag(NH3)2]Cl

3. K3[Fe(CN)6]

4. [Co(NH3)5NO2]Cl2

5. K2[Co(CSN)4]

Вопрос 5. Исходя из величины константы нестойкости (приложение 5), укажите, какой из приведенных комплексных ионов является наиболее прочным?

1. [Ag(NH3)2]+

2. [Ni(CN)4]2-

3. [HgI4]2-

4. [HgBr4]2-

5. [HgCl4]2-



Задание 10
Вопрос 1. Пользуясь таблицей термодинамических характеристик некоторых веществ (приложение 2), рассчитайте энтальпии следующих реакций: а)CH4+2O2=CO2+2H2O, б)CH4+2H2O(г)= CO2+4H2. Укажите эндо- или экзотермическими являются эти реакции.

1. обе экзотермические

2. обе эндотермические

3. а) эндотермическая, б) экзотермическая

4. а) экзотермическая, б) эндотермическая

5. нет правильного ответа

Вопрос 2. Не производя расчетов, определите знак изменения энтропии ( S) в следующих реакциях: а)CH4(г)+H2O(г)=CO(г)+3H2(г), б)C2H5OH(ж)=C2H4(г)+H2O(г), в)N2(г)+3H2(г)=2NH3(г).

1. а) S>0, б) S0, в) S0, б) S>0, в) S>0

Вопрос 3. Пользуясь таблицей термодинамических характеристик определите изменение энергии Гиббса химических реакций: а) 2Ca+O2=2CaO, б) 2CO+O2=2CO2, в) N2+O2=2NO при стандартных условиях. Укажите знак изменения G .

1. а) G0

3. а) G>0, б) G

Наверх

www.webmoney.ru Яндекс цитирования Рейтинг@Mail.ru Студенческий Маяк © 2010 - 2012   ИП Каминская О.В. ОГРНИП 310774602801230
При использовании материалов активная ссылка на StudMayak.ru обязательна.